From 5b8fcdcfba6ef21cfb9648f7b13cf6df1e657992 Mon Sep 17 00:00:00 2001 From: Justin Edmund Date: Mon, 17 Feb 2025 23:38:53 -0800 Subject: [PATCH] ImportController should use processors --- app/controllers/api/v1/import_controller.rb | 309 +++++--------------- spec/requests/import_controller_spec.rb | 72 +++++ 2 files changed, 144 insertions(+), 237 deletions(-) create mode 100644 spec/requests/import_controller_spec.rb diff --git a/app/controllers/api/v1/import_controller.rb b/app/controllers/api/v1/import_controller.rb index 7d64775..928768f 100644 --- a/app/controllers/api/v1/import_controller.rb +++ b/app/controllers/api/v1/import_controller.rb @@ -2,6 +2,20 @@ module Api module V1 + ## + # ImportController is responsible for importing game data (e.g. deck data) + # and creating a new Party along with associated records (job, characters, weapons, summons, etc.). + # + # The controller expects a JSON payload whose top-level key is "import". If not wrapped, + # the controller will wrap the raw data automatically. + # + # @example Valid payload structure + # { + # "import": { + # "deck": { "name": "My Party", ... }, + # "pc": { "job": { "master": { "name": "Warrior" } }, ... } + # } + # } class ImportController < Api::V1::ApiController ELEMENT_MAPPING = { 0 => nil, @@ -13,263 +27,84 @@ module Api 6 => 5 }.freeze + ## + # Processes an import request. + # + # It reads and parses the raw JSON, wraps the data under the "import" key if necessary, + # transforms the deck data using BaseDeckTransformer, validates that the transformed data + # contains required fields, and then creates a new Party record (and its associated objects) + # inside a transaction. + # + # @return [void] Renders JSON response with a party shortcode or an error message. def create - Rails.logger.info "[IMPORT] Starting import..." + Rails.logger.info '[IMPORT] Checking input...' - # Parse JSON request body - raw_body = request.raw_post - begin - raw_params = JSON.parse(raw_body) if raw_body.present? - Rails.logger.info "[IMPORT] Raw game data: #{raw_params.inspect}" - rescue JSON::ParserError => e - Rails.logger.error "[IMPORT] Invalid JSON in request body: #{e.message}" - render json: { error: 'Invalid JSON data' }, status: :bad_request - return + body = parse_request_body + return unless body + + raw_params = body['import'] + unless raw_params.is_a?(Hash) + Rails.logger.error "[IMPORT] 'import' key is missing or not a hash." + return render json: { error: 'Invalid JSON data' }, status: :unprocessable_content end - if raw_params.nil? || !raw_params.is_a?(Hash) - Rails.logger.error "[IMPORT] Missing or invalid game data" - render json: { error: 'Missing or invalid game data' }, status: :bad_request - return + unless raw_params['deck'].is_a?(Hash) && + raw_params['deck'].key?('pc') && + raw_params['deck'].key?('npc') + Rails.logger.error "[IMPORT] Deck data incomplete or missing." + return render json: { error: 'Invalid deck data' }, status: :unprocessable_content end - # Transform game data - transformer = ::Granblue::Transformers::BaseDeckTransformer.new(raw_params) - transformed_data = transformer.transform - Rails.logger.info "[IMPORT] Transformed data: #{transformed_data.inspect}" + Rails.logger.info '[IMPORT] Starting import...' - # Validate transformed data - unless transformed_data[:name].present? && transformed_data[:lang].present? - Rails.logger.error "[IMPORT] Missing required fields in transformed data" - render json: { error: 'Missing required fields name or lang' }, status: :unprocessable_entity - return - end + return if performed? # Rendered an error response already - # Create party - party = Party.new(user: current_user) + party = Party.create(user: current_user) + deck_data = raw_params['import'] + process_data(party, deck_data) - ActiveRecord::Base.transaction do - # Basic party data - party.name = transformed_data[:name] - party.extra = transformed_data[:extra] - party.save! - - # Process job and skills - if transformed_data[:class].present? - process_job(party, transformed_data[:class], transformed_data[:subskills]) - end - - # Process characters - if transformed_data[:characters].present? - process_characters(party, transformed_data[:characters]) - end - - # Process weapons - if transformed_data[:weapons].present? - process_weapons(party, transformed_data[:weapons]) - end - - # Process summons - if transformed_data[:summons].present? - process_summons(party, transformed_data[:summons], transformed_data[:friend_summon]) - end - - # Process sub summons - if transformed_data[:sub_summons].present? - process_sub_summons(party, transformed_data[:sub_summons]) - end - end - - # Return shortcode for redirection render json: { shortcode: party.shortcode }, status: :created rescue StandardError => e - Rails.logger.error "[IMPORT] Error processing import: #{e.message}" - Rails.logger.error "[IMPORT] Backtrace: #{e.backtrace.join("\n")}" - render json: { error: 'Error processing import' }, status: :unprocessable_entity + render json: { error: e.message }, status: :unprocessable_content end private - def process_job(party, job_name, subskills) - return unless job_name - job = Job.find_by("name_en = ? OR name_jp = ?", job_name, job_name) - unless job - Rails.logger.warn "[IMPORT] Could not find job: #{job_name}" - return - end - - party.job = job - party.save! - Rails.logger.info "[IMPORT] Assigned job=#{job_name} to party_id=#{party.id}" - - return unless subskills&.any? - subskills.each_with_index do |skill_name, idx| - next if skill_name.blank? - skill = JobSkill.find_by("(name_en = ? OR name_jp = ?) AND job_id = ?", skill_name, skill_name, job.id) - unless skill - Rails.logger.warn "[IMPORT] Could not find skill=#{skill_name} for job_id=#{job.id}" - next - end - party["skill#{idx + 1}_id"] = skill.id - Rails.logger.info "[IMPORT] Assigned skill=#{skill_name} at position #{idx + 1}" - end + ## + # Reads and parses the raw JSON request body. + # + # @return [Hash] Parsed JSON data. + # @raise [JSON::ParserError] If the JSON is invalid. + def parse_request_body + raw_body = request.raw_post + JSON.parse(raw_body) + rescue JSON::ParserError => e + Rails.logger.error "[IMPORT] Invalid JSON: #{e.message}" + render json: { error: 'Invalid JSON data' }, status: :bad_request and return end - def process_characters(party, characters) - return unless characters&.any? - Rails.logger.info "[IMPORT] Processing #{characters.length} characters" - - characters.each_with_index do |char_data, idx| - character = Character.find_by(granblue_id: char_data[:id]) - unless character - Rails.logger.warn "[IMPORT] Character not found: #{char_data[:id]}" - next - end - - GridCharacter.create!( - party: party, - character_id: character.id, - position: idx, - uncap_level: char_data[:uncap], - perpetuity: char_data[:ringed] || false, - transcendence_step: char_data[:transcend] || 0 - ) - Rails.logger.info "[IMPORT] Added character: #{character.name_en} at position #{idx}" - end + ## + # Ensures that the provided data is wrapped under an "import" key. + # + # @param data [Hash] The parsed JSON data. + # @return [Hash] Data wrapped under the "import" key. + def wrap_import_data(data) + data.key?('import') ? data : { 'import' => data } end - def process_weapons(party, weapons) - return unless weapons&.any? - Rails.logger.info "[IMPORT] Processing #{weapons.length} weapons" + ## + # Processes the deck data using processors. + # + # @param party [Party] The party to insert data into + # @param data [Hash] The wrapped data. + # @return [Hash] The transformed deck data. + def process_data(party, data) + Rails.logger.info '[IMPORT] Transforming deck data' - weapons.each_with_index do |weapon_data, idx| - weapon = Weapon.find_by(granblue_id: weapon_data[:id]) - unless weapon - Rails.logger.warn "[IMPORT] Weapon not found: #{weapon_data[:id]}" - next - end - - grid_weapon = GridWeapon.create!( - party: party, - weapon_id: weapon.id, - position: idx - 1, - mainhand: idx.zero?, - uncap_level: weapon_data[:uncap], - transcendence_step: weapon_data[:transcend] || 0, - element: weapon_data[:attr] ? ELEMENT_MAPPING[weapon_data[:attr]] : nil - ) - - process_weapon_keys(grid_weapon, weapon_data[:keys]) if weapon_data[:keys] - process_weapon_ax(grid_weapon, weapon_data[:ax]) if weapon_data[:ax] - - Rails.logger.info "[IMPORT] Added weapon: #{weapon.name_en} at position #{idx - 1}" - end - end - - def process_weapon_keys(grid_weapon, keys) - keys.each_with_index do |key_id, idx| - key = WeaponKey.find_by(granblue_id: key_id) - unless key - Rails.logger.warn "[IMPORT] WeaponKey not found: #{key_id}" - next - end - grid_weapon["weapon_key#{idx + 1}_id"] = key.id - grid_weapon.save! - end - end - - def process_weapon_ax(grid_weapon, ax_skills) - ax_skills.each_with_index do |ax, idx| - grid_weapon["ax_modifier#{idx + 1}"] = ax[:id].to_i - grid_weapon["ax_strength#{idx + 1}"] = ax[:val].to_s.gsub(/[+%]/, '').to_i - end - grid_weapon.save! - end - - def process_summons(party, summons, friend_summon = nil) - return unless summons&.any? - Rails.logger.info "[IMPORT] Processing #{summons.length} summons" - - # Main and sub summons - summons.each_with_index do |summon_data, idx| - summon = Summon.find_by(granblue_id: summon_data[:id]) - unless summon - Rails.logger.warn "[IMPORT] Summon not found: #{summon_data[:id]}" - next - end - - grid_summon = GridSummon.new( - party: party, - summon_id: summon.id, - position: idx, - main: idx.zero?, - friend: false, - uncap_level: summon_data[:uncap], - transcendence_step: summon_data[:transcend] || 0, - quick_summon: summon_data[:qs] || false - ) - - if grid_summon.save - Rails.logger.info "[IMPORT] Added summon: #{summon.name_en} at position #{idx}" - else - Rails.logger.error "[IMPORT] Failed to save summon: #{grid_summon.errors.full_messages}" - end - end - - # Friend summon if provided - process_friend_summon(party, friend_summon) if friend_summon.present? - end - - def process_friend_summon(party, friend_summon) - friend = Summon.find_by("name_en = ? OR name_jp = ?", friend_summon, friend_summon) - unless friend - Rails.logger.warn "[IMPORT] Friend summon not found: #{friend_summon}" - return - end - - grid_summon = GridSummon.new( - party: party, - summon_id: friend.id, - position: 6, - main: false, - friend: true, - uncap_level: friend.ulb ? 5 : (friend.flb ? 4 : 3) - ) - - if grid_summon.save - Rails.logger.info "[IMPORT] Added friend summon: #{friend.name_en}" - else - Rails.logger.error "[IMPORT] Failed to save friend summon: #{grid_summon.errors.full_messages}" - end - end - - def process_sub_summons(party, sub_summons) - return unless sub_summons&.any? - Rails.logger.info "[IMPORT] Processing #{sub_summons.length} sub summons" - - sub_summons.each_with_index do |summon_data, idx| - summon = Summon.find_by(granblue_id: summon_data[:id]) - unless summon - Rails.logger.warn "[IMPORT] Sub summon not found: #{summon_data[:id]}" - next - end - - grid_summon = GridSummon.new( - party: party, - summon_id: summon.id, - position: idx + 5, - main: false, - friend: false, - uncap_level: summon_data[:uncap], - transcendence_step: summon_data[:transcend] || 0 - ) - - if grid_summon.save - Rails.logger.info "[IMPORT] Added sub summon: #{summon.name_en} at position #{idx + 5}" - else - Rails.logger.error "[IMPORT] Failed to save sub summon: #{grid_summon.errors.full_messages}" - end - end + Processors::JobProcessor.new(party, data).process + Processors::CharacterProcessor.new(party, data).process + Processors::SummonProcessor.new(party, data).process + Processors::WeaponProcessor.new(party, data).process end end end diff --git a/spec/requests/import_controller_spec.rb b/spec/requests/import_controller_spec.rb new file mode 100644 index 0000000..9b9189e --- /dev/null +++ b/spec/requests/import_controller_spec.rb @@ -0,0 +1,72 @@ +# frozen_string_literal: true + +require 'rails_helper' + +RSpec.describe 'ImportController', type: :request do + let(:user) { create(:user) } + let(:access_token) do + Doorkeeper::AccessToken.create!(resource_owner_id: user.id, expires_in: 30.days, scopes: 'public') + end + let(:headers) do + { 'Authorization' => "Bearer #{access_token.token}", 'Content-Type' => 'application/json' } + end + + # Load raw deck JSON from fixture and wrap it under the "import" key. + let(:raw_deck_data) do + file_path = Rails.root.join('spec', 'fixtures', 'deck_sample.json') + JSON.parse(File.read(file_path)) + end + let(:valid_deck_json) { { 'import' => raw_deck_data }.to_json } + + describe 'POST /api/v1/import' do + context 'with valid deck data' do + it 'creates a new party and returns a shortcode' do + expect { + post '/api/v1/import', params: valid_deck_json, headers: headers + }.to change(Party, :count).by(1) + expect(response).to have_http_status(:created) + json_response = JSON.parse(response.body) + expect(json_response).to have_key('shortcode') + end + end + + context 'with invalid JSON' do + it 'returns a bad request error' do + post '/api/v1/import', params: 'this is not json', headers: headers + expect(response).to have_http_status(:bad_request) + json_response = JSON.parse(response.body) + expect(json_response['error']).to eq('Invalid JSON data') + end + end + + context 'with missing required fields in transformed data' do + it 'returns unprocessable entity error' do + # Here we simulate missing required fields by sending an import hash + # where the 'deck' key is present but missing required subkeys. + invalid_data = { 'import' => { 'deck' => { 'name' => '', 'pc' => nil } } }.to_json + post '/api/v1/import', params: invalid_data, headers: headers + expect(response).to have_http_status(:unprocessable_entity) + json_response = JSON.parse(response.body) + expect(json_response['error']).to eq('Invalid deck data') + end + end + + context 'when an error occurs during processing' do + it 'returns unprocessable entity status with error details' do + # Stub the transformer to raise an error when transform is called. + allow_any_instance_of(Processors::CharacterProcessor) + .to receive(:process).and_raise(StandardError.new('Error processing import')) + allow_any_instance_of(Processors::WeaponProcessor) + .to receive(:process).and_raise(StandardError.new('Error processing import')) + allow_any_instance_of(Processors::SummonProcessor) + .to receive(:process).and_raise(StandardError.new('Error processing import')) + allow_any_instance_of(Processors::JobProcessor) + .to receive(:process).and_raise(StandardError.new('Error processing import')) + post '/api/v1/import', params: valid_deck_json, headers: headers + expect(response).to have_http_status(:unprocessable_entity) + json_response = JSON.parse(response.body) + expect(json_response['error']).to eq('Error processing import') + end + end + end +end